About 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine
1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine (PubChem CID 118171048) has the molecular formula C11H13F3N4O
and a molecular weight of 274.25 g/mol. Its IUPAC name is 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine.
Molecular Properties
| Compound Name | 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine |
| PubChem CID | 118171048 |
| Molecular Formula | C11H13F3N4O |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine |
| SMILES | CCc1cc(Cn2nc(C(F)(F)F)c(N)c2C)on1 |
| InChI | InChI=1S/C11H13F3N4O/c1-3-7-4-8(19-17-7)5-18-6(2)9(15)10(16-18)11(12,13)14/h4H,3,5,15H2,1-2H3 |
| InChIKey | XNVCCDYKAOLPAP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine?
The IUPAC name of 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine (CID 118171048) is 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine.
What is the SMILES notation for 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine?
The canonical SMILES for 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine is CCc1cc(Cn2nc(C(F)(F)F)c(N)c2C)on1.
What is the InChIKey of 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine?
The InChIKey is XNVCCDYKAOLPAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3N4O/c1-3-7-4-8(19-17-7)5-18-6(2)9(15)10(16-18)11(12,13)14/h4H,3,5,15H2,1-2H3.
What are the key properties of 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine?
1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine has a molecular weight of 274.25 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-ethyl-1,2-oxazol-5-yl)methyl]-5-methyl-3-(trifluoromethyl)pyrazol-4-amine is sourced from PubChem (CID 118171048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).