C10H20N2O4 — CID 11817129
(4R,5R)-N-(3-aminopropyl)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolane-4-carboxamide (PubChem CID 11817129) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is (4R,5R)-N-(3-aminopropyl)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolane-4-carboxamide.
| Compound Name | (4R,5R)-N-(3-aminopropyl)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolane-4-carboxamide |
|---|---|
| PubChem CID | 11817129 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | (4R,5R)-N-(3-aminopropyl)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolane-4-carboxamide |
| SMILES | CC1(C)O[C@H](CO)[C@H](C(=O)NCCCN)O1 |
| InChI | InChI=1S/C10H20N2O4/c1-10(2)15-7(6-13)8(16-10)9(14)12-5-3-4-11/h7-8,13H,3-6,11H2,1-2H3,(H,12,14)/t7-,8-/m1/s1 |
| InChIKey | HASKRFWFNFHCKK-HTQZYQBOSA-N |
| XLogP | -1.04 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|