About 5-undecyl-1,2,4-oxadiazol-3-amine
5-undecyl-1,2,4-oxadiazol-3-amine (PubChem CID 11817293) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is 5-undecyl-1,2,4-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 5-undecyl-1,2,4-oxadiazol-3-amine |
| PubChem CID | 11817293 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 5-undecyl-1,2,4-oxadiazol-3-amine |
| SMILES | CCCCCCCCCCCc1nc(N)no1 |
| InChI | InChI=1S/C13H25N3O/c1-2-3-4-5-6-7-8-9-10-11-12-15-13(14)16-17-12/h2-11H2,1H3,(H2,14,16) |
| InChIKey | XDUFMXDQJRWGRW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-undecyl-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-undecyl-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-undecyl-1,2,4-oxadiazol-3-amine (CID 11817293) is 5-undecyl-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-undecyl-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-undecyl-1,2,4-oxadiazol-3-amine is CCCCCCCCCCCc1nc(N)no1.
What is the InChIKey of 5-undecyl-1,2,4-oxadiazol-3-amine?
The InChIKey is XDUFMXDQJRWGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O/c1-2-3-4-5-6-7-8-9-10-11-12-15-13(14)16-17-12/h2-11H2,1H3,(H2,14,16).
What are the key properties of 5-undecyl-1,2,4-oxadiazol-3-amine?
5-undecyl-1,2,4-oxadiazol-3-amine has a molecular weight of 239.36 g/mol, XLogP of 3.73, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-undecyl-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 11817293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).