About 5H-triazolo[5,1-a]isoindol-1-ylmethanol
5H-triazolo[5,1-a]isoindol-1-ylmethanol (PubChem CID 118173407) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 5H-triazolo[5,1-a]isoindol-1-ylmethanol.
Molecular Properties
| Compound Name | 5H-triazolo[5,1-a]isoindol-1-ylmethanol |
| PubChem CID | 118173407 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 5H-triazolo[5,1-a]isoindol-1-ylmethanol |
| SMILES | OCc1nnn2c1-c1ccccc1C2 |
| InChI | InChI=1S/C10H9N3O/c14-6-9-10-8-4-2-1-3-7(8)5-13(10)12-11-9/h1-4,14H,5-6H2 |
| InChIKey | IDSIBASTNIMWOR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5H-triazolo[5,1-a]isoindol-1-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-triazolo[5,1-a]isoindol-1-ylmethanol?
The IUPAC name of 5H-triazolo[5,1-a]isoindol-1-ylmethanol (CID 118173407) is 5H-triazolo[5,1-a]isoindol-1-ylmethanol.
What is the SMILES notation for 5H-triazolo[5,1-a]isoindol-1-ylmethanol?
The canonical SMILES for 5H-triazolo[5,1-a]isoindol-1-ylmethanol is OCc1nnn2c1-c1ccccc1C2.
What is the InChIKey of 5H-triazolo[5,1-a]isoindol-1-ylmethanol?
The InChIKey is IDSIBASTNIMWOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c14-6-9-10-8-4-2-1-3-7(8)5-13(10)12-11-9/h1-4,14H,5-6H2.
What are the key properties of 5H-triazolo[5,1-a]isoindol-1-ylmethanol?
5H-triazolo[5,1-a]isoindol-1-ylmethanol has a molecular weight of 187.20 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-triazolo[5,1-a]isoindol-1-ylmethanol is sourced from PubChem (CID 118173407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).