C17H18N2O6 — CID 118173469
2-(3,4-dihydroxyphenyl)ethyl-[1-(2-nitrophenyl)ethyl]carbamic acid (PubChem CID 118173469) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)ethyl-[1-(2-nitrophenyl)ethyl]carbamic acid.
| Compound Name | 2-(3,4-dihydroxyphenyl)ethyl-[1-(2-nitrophenyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 118173469 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)ethyl-[1-(2-nitrophenyl)ethyl]carbamic acid |
| SMILES | CC(c1ccccc1[N+](=O)[O-])N(CCc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C17H18N2O6/c1-11(13-4-2-3-5-14(13)19(24)25)18(17(22)23)9-8-12-6-7-15(20)16(21)10-12/h2-7,10-11,20-21H,8-9H2,1H3,(H,22,23) |
| InChIKey | ZPUUUTJZMNRGOR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|