C21H23FN4O — CID 118173507
3-[1-[[1-[(5-fluoro-2-pyridinyl)methyl]pyrazol-4-yl]methyl]piperidin-4-yl]phenol (PubChem CID 118173507) has the molecular formula C21H23FN4O and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-[1-[[1-[(5-fluoro-2-pyridinyl)methyl]pyrazol-4-yl]methyl]piperidin-4-yl]phenol.
| Compound Name | 3-[1-[[1-[(5-fluoro-2-pyridinyl)methyl]pyrazol-4-yl]methyl]piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 118173507 |
| Molecular Formula | C21H23FN4O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-[1-[[1-[(5-fluoro-2-pyridinyl)methyl]pyrazol-4-yl]methyl]piperidin-4-yl]phenol |
| SMILES | Oc1cccc(C2CCN(Cc3cnn(Cc4ccc(F)cn4)c3)CC2)c1 |
| InChI | InChI=1S/C21H23FN4O/c22-19-4-5-20(23-12-19)15-26-14-16(11-24-26)13-25-8-6-17(7-9-25)18-2-1-3-21(27)10-18/h1-5,10-12,14,17,27H,6-9,13,15H2 |
| InChIKey | UOQNUZKMFSAOMT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |