C8H10O8 — CID 118173855
[(3S,3aR,6S,6aR)-6-carboxyoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] hydrogen carbonate (PubChem CID 118173855) has the molecular formula C8H10O8 and a molecular weight of 234.16 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-6-carboxyoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] hydrogen carbonate.
| Compound Name | [(3S,3aR,6S,6aR)-6-carboxyoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 118173855 |
| Molecular Formula | C8H10O8 |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | [(3S,3aR,6S,6aR)-6-carboxyoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] hydrogen carbonate |
| SMILES | O=C(O)O[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC(=O)O |
| InChI | InChI=1S/C8H10O8/c9-7(10)15-3-1-13-6-4(16-8(11)12)2-14-5(3)6/h3-6H,1-2H2,(H,9,10)(H,11,12)/t3-,4-,5+,6+/m0/s1 |
| InChIKey | KDPUSKMIIVTYTH-UNTFVMJOSA-N |
| XLogP | -0.09 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |