About 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid
3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid (PubChem CID 118174344) has the molecular formula C13H13IN2O4
and a molecular weight of 388.16 g/mol. Its IUPAC name is 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid.
Molecular Properties
| Compound Name | 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid |
| PubChem CID | 118174344 |
| Molecular Formula | C13H13IN2O4 |
| Molecular Weight | 388.16 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid |
| SMILES | Cc1ccc2c(n1)C1(CCN(C(=O)O)CC1I)OC2=O |
| InChI | InChI=1S/C13H13IN2O4/c1-7-2-3-8-10(15-7)13(20-11(8)17)4-5-16(12(18)19)6-9(13)14/h2-3,9H,4-6H2,1H3,(H,18,19) |
| InChIKey | MUFOFXYFULNFCB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid?
The IUPAC name of 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid (CID 118174344) is 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid.
What is the SMILES notation for 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid?
The canonical SMILES for 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid is Cc1ccc2c(n1)C1(CCN(C(=O)O)CC1I)OC2=O.
What is the InChIKey of 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid?
The InChIKey is MUFOFXYFULNFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13IN2O4/c1-7-2-3-8-10(15-7)13(20-11(8)17)4-5-16(12(18)19)6-9(13)14/h2-3,9H,4-6H2,1H3,(H,18,19).
What are the key properties of 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid?
3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid has a molecular weight of 388.16 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-iodo-2-methyl-5-oxospiro[furo[3,4-b]pyridine-7,4'-piperidine]-1'-carboxylic acid is sourced from PubChem (CID 118174344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).