About 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid
3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid (PubChem CID 118174949) has the molecular formula C22H19ClN2O3
and a molecular weight of 394.86 g/mol. Its IUPAC name is 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid |
| PubChem CID | 118174949 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid |
| SMILES | Cc1ccc(-c2ccc(Cl)cc2)nc1C(=O)Nc1c(C)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C22H19ClN2O3/c1-12-4-10-17(22(27)28)14(3)19(12)25-21(26)20-13(2)5-11-18(24-20)15-6-8-16(23)9-7-15/h4-11H,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | JHDFNHKWAIIJMJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid?
The IUPAC name of 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid (CID 118174949) is 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid.
What is the SMILES notation for 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid?
The canonical SMILES for 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid is Cc1ccc(-c2ccc(Cl)cc2)nc1C(=O)Nc1c(C)ccc(C(=O)O)c1C.
What is the InChIKey of 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid?
The InChIKey is JHDFNHKWAIIJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19ClN2O3/c1-12-4-10-17(22(27)28)14(3)19(12)25-21(26)20-13(2)5-11-18(24-20)15-6-8-16(23)9-7-15/h4-11H,1-3H3,(H,25,26)(H,27,28).
What are the key properties of 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid?
3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid has a molecular weight of 394.86 g/mol, XLogP of 5.28, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[6-(4-chlorophenyl)-3-methylpyridine-2-carbonyl]amino]-2,4-dimethylbenzoic acid is sourced from PubChem (CID 118174949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).