About 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid
3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid (PubChem CID 118175029) has the molecular formula C23H20FNO4
and a molecular weight of 393.41 g/mol. Its IUPAC name is 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid |
| PubChem CID | 118175029 |
| Molecular Formula | C23H20FNO4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(C)c1NC(=O)c1cc(-c2cccc(CO)c2)ccc1F |
| InChI | InChI=1S/C23H20FNO4/c1-13-6-8-18(23(28)29)14(2)21(13)25-22(27)19-11-17(7-9-20(19)24)16-5-3-4-15(10-16)12-26/h3-11,26H,12H2,1-2H3,(H,25,27)(H,28,29) |
| InChIKey | ZKYCXNSABHUSTB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid?
The IUPAC name of 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid (CID 118175029) is 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid.
What is the SMILES notation for 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid?
The canonical SMILES for 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid is Cc1ccc(C(=O)O)c(C)c1NC(=O)c1cc(-c2cccc(CO)c2)ccc1F.
What is the InChIKey of 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid?
The InChIKey is ZKYCXNSABHUSTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20FNO4/c1-13-6-8-18(23(28)29)14(2)21(13)25-22(27)19-11-17(7-9-20(19)24)16-5-3-4-15(10-16)12-26/h3-11,26H,12H2,1-2H3,(H,25,27)(H,28,29).
What are the key properties of 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid?
3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid has a molecular weight of 393.41 g/mol, XLogP of 4.55, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-fluoro-5-[3-(hydroxymethyl)phenyl]benzoyl]amino]-2,4-dimethylbenzoic acid is sourced from PubChem (CID 118175029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).