C26H34F2O4 — CID 118175467
1-[(2R,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-1,1-difluoro-2-methylpropan-2-ol (PubChem CID 118175467) has the molecular formula C26H34F2O4 and a molecular weight of 448.55 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-1,1-difluoro-2-methylpropan-2-ol.
| Compound Name | 1-[(2R,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-1,1-difluoro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 118175467 |
| Molecular Formula | C26H34F2O4 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-[(2R,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-1,1-difluoro-2-methylpropan-2-ol |
| SMILES | CC[C@H]1O[C@@H](C(F)(F)C(C)(C)O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C26H34F2O4/c1-5-21-18(2)22(30-16-19-12-8-6-9-13-19)23(31-17-20-14-10-7-11-15-20)24(32-21)26(27,28)25(3,4)29/h6-15,18,21-24,29H,5,16-17H2,1-4H3/t18-,21+,22-,23+,24+/m0/s1 |
| InChIKey | LGMSDMYJFGHTOZ-GPDNFFQDSA-N |
| XLogP | 5.38 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |