C21H14ClF2N3O2 — CID 118175967
5-[4-chloro-3-(1,1-difluoroethyl)anilino]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 118175967) has the molecular formula C21H14ClF2N3O2 and a molecular weight of 413.81 g/mol. Its IUPAC name is 5-[4-chloro-3-(1,1-difluoroethyl)anilino]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[4-chloro-3-(1,1-difluoroethyl)anilino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 118175967 |
| Molecular Formula | C21H14ClF2N3O2 |
| Molecular Weight | 413.81 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 5-[4-chloro-3-(1,1-difluoroethyl)anilino]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | CC(F)(F)c1cc(Nc2nc3cc(C(=O)O)ccc3c3cnccc23)ccc1Cl |
| InChI | InChI=1S/C21H14ClF2N3O2/c1-21(23,24)16-9-12(3-5-17(16)22)26-19-14-6-7-25-10-15(14)13-4-2-11(20(28)29)8-18(13)27-19/h2-10H,1H3,(H,26,27)(H,28,29) |
| InChIKey | HXUHRZHSQILWMF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.81 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|