C25H34O7S — CID 118175993
tert-butyl (5R)-5-[[(2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-3-methyl-5-prop-2-enyloxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate (PubChem CID 118175993) has the molecular formula C25H34O7S and a molecular weight of 478.61 g/mol. Its IUPAC name is tert-butyl (5R)-5-[[(2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-3-methyl-5-prop-2-enyloxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate.
| Compound Name | tert-butyl (5R)-5-[[(2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-3-methyl-5-prop-2-enyloxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 118175993 |
| Molecular Formula | C25H34O7S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | tert-butyl (5R)-5-[[(2R,3R,4R,5S)-4-(benzenesulfonylmethyl)-3-methyl-5-prop-2-enyloxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate |
| SMILES | C=CC[C@@H]1O[C@H](C[C@H]2CC(C(=O)OC(C)(C)C)C(=O)O2)[C@H](C)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H34O7S/c1-6-10-21-20(15-33(28,29)18-11-8-7-9-12-18)16(2)22(31-21)14-17-13-19(23(26)30-17)24(27)32-25(3,4)5/h6-9,11-12,16-17,19-22H,1,10,13-15H2,2-5H3/t16-,17-,19?,20-,21+,22-/m1/s1 |
| InChIKey | OXKMYJFGGBKJAB-MRCOLMTRSA-N |
| XLogP | 3.72 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|