C12H12N2 — CID 118176144
(3Z,5Z)-7-methylidene-2H-pyrido[1,2-a][1,3]diazonine (PubChem CID 118176144) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (3Z,5Z)-7-methylidene-2H-pyrido[1,2-a][1,3]diazonine.
| Compound Name | (3Z,5Z)-7-methylidene-2H-pyrido[1,2-a][1,3]diazonine |
|---|---|
| PubChem CID | 118176144 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (3Z,5Z)-7-methylidene-2H-pyrido[1,2-a][1,3]diazonine |
| SMILES | C=C1/C=C\C=C/C/N=C2/C=CC=CN12 |
| InChI | InChI=1S/C12H12N2/c1-11-7-3-2-5-9-13-12-8-4-6-10-14(11)12/h2-8,10H,1,9H2/b5-2-,7-3-,13-12- |
| InChIKey | XUSXKVRTRACVMY-GSHQHOSZSA-N |
| XLogP | 2.41 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |