C25H34O8S — CID 118176339
tert-butyl (5R)-5-[[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-prop-2-enyloxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate (PubChem CID 118176339) has the molecular formula C25H34O8S and a molecular weight of 494.61 g/mol. Its IUPAC name is tert-butyl (5R)-5-[[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-prop-2-enyloxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate.
| Compound Name | tert-butyl (5R)-5-[[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-prop-2-enyloxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 118176339 |
| Molecular Formula | C25H34O8S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | tert-butyl (5R)-5-[[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-prop-2-enyloxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate |
| SMILES | C=CC[C@@H]1O[C@H](C[C@H]2CC(C(=O)OC(C)(C)C)C(=O)O2)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H34O8S/c1-6-10-20-19(15-34(28,29)17-11-8-7-9-12-17)22(30-5)21(32-20)14-16-13-18(23(26)31-16)24(27)33-25(2,3)4/h6-9,11-12,16,18-22H,1,10,13-15H2,2-5H3/t16-,18?,19+,20+,21-,22-/m1/s1 |
| InChIKey | KCWKNEHONWDRLP-PXHJZDJMSA-N |
| XLogP | 3.10 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|