C24H32O9S — CID 118176340
tert-butyl (5R)-5-[[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(2-oxoethyl)oxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate (PubChem CID 118176340) has the molecular formula C24H32O9S and a molecular weight of 496.58 g/mol. Its IUPAC name is tert-butyl (5R)-5-[[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(2-oxoethyl)oxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate.
| Compound Name | tert-butyl (5R)-5-[[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(2-oxoethyl)oxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 118176340 |
| Molecular Formula | C24H32O9S |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | tert-butyl (5R)-5-[[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-3-methoxy-5-(2-oxoethyl)oxolan-2-yl]methyl]-2-oxooxolane-3-carboxylate |
| SMILES | CO[C@@H]1[C@@H](CS(=O)(=O)c2ccccc2)[C@H](CC=O)O[C@@H]1C[C@H]1CC(C(=O)OC(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C24H32O9S/c1-24(2,3)33-23(27)17-12-15(31-22(17)26)13-20-21(30-4)18(19(32-20)10-11-25)14-34(28,29)16-8-6-5-7-9-16/h5-9,11,15,17-21H,10,12-14H2,1-4H3/t15-,17?,18+,19+,20-,21-/m1/s1 |
| InChIKey | CRPHTOMONZBTMH-CJWWDLJWSA-N |
| XLogP | 2.11 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|