About 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine
2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine (PubChem CID 118176547) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine.
Molecular Properties
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine |
| PubChem CID | 118176547 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine |
| SMILES | [H]/N=C(\CN)C1=CCCC=C1 |
| InChI | InChI=1S/C8H12N2/c9-6-8(10)7-4-2-1-3-5-7/h2,4-5,10H,1,3,6,9H2/b10-8+ |
| InChIKey | XVSGXGHHISHUEO-CSKARUKUSA-N |
| XLogP | 1.24 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine?
The IUPAC name of 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine (CID 118176547) is 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine.
What is the SMILES notation for 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine?
The canonical SMILES for 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine is [H]/N=C(\CN)C1=CCCC=C1.
What is the InChIKey of 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine?
The InChIKey is XVSGXGHHISHUEO-CSKARUKUSA-N. The full InChI is InChI=1S/C8H12N2/c9-6-8(10)7-4-2-1-3-5-7/h2,4-5,10H,1,3,6,9H2/b10-8+.
What are the key properties of 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine?
2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine has a molecular weight of 136.20 g/mol, XLogP of 1.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,5-dien-1-yl-2-iminoethanamine is sourced from PubChem (CID 118176547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).