C20H20N4O2 — CID 118177559
ethyl 2-(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)-2-phenylacetate (PubChem CID 118177559) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is ethyl 2-(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)-2-phenylacetate.
| Compound Name | ethyl 2-(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)-2-phenylacetate |
|---|---|
| PubChem CID | 118177559 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | ethyl 2-(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl)-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)n1c(C)cc2c1ccc1nnc(C)n12 |
| InChI | InChI=1S/C20H20N4O2/c1-4-26-20(25)19(15-8-6-5-7-9-15)23-13(2)12-17-16(23)10-11-18-22-21-14(3)24(17)18/h5-12,19H,4H2,1-3H3 |
| InChIKey | CDPBLWPUSFNPMU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |