About 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine
1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine (PubChem CID 118177560) has the molecular formula C16H17N5
and a molecular weight of 279.35 g/mol. Its IUPAC name is 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine.
Molecular Properties
| Compound Name | 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine |
| PubChem CID | 118177560 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine |
| SMILES | [H]/N=C(\C)n1/c(=N/[H])ccc2c1nc(C)n2Cc1ccccc1 |
| InChI | InChI=1S/C16H17N5/c1-11(17)21-15(18)9-8-14-16(21)19-12(2)20(14)10-13-6-4-3-5-7-13/h3-9,17-18H,10H2,1-2H3/b17-11+,18-15+ |
| InChIKey | OKLDYRCYAKWHQC-OVHYJKADSA-N |
| XLogP | 2.52 |
| TPSA | 70.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine?
The IUPAC name of 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine (CID 118177560) is 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine.
What is the SMILES notation for 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine?
The canonical SMILES for 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine is [H]/N=C(\C)n1/c(=N/[H])ccc2c1nc(C)n2Cc1ccccc1.
What is the InChIKey of 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine?
The InChIKey is OKLDYRCYAKWHQC-OVHYJKADSA-N. The full InChI is InChI=1S/C16H17N5/c1-11(17)21-15(18)9-8-14-16(21)19-12(2)20(14)10-13-6-4-3-5-7-13/h3-9,17-18H,10H2,1-2H3/b17-11+,18-15+.
What are the key properties of 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine?
1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine has a molecular weight of 279.35 g/mol, XLogP of 2.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-ethanimidoyl-2-methylimidazo[4,5-b]pyridin-5-imine is sourced from PubChem (CID 118177560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).