C9H21N3 — CID 118177643
1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopropane-1,2,3-triamine (PubChem CID 118177643) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopropane-1,2,3-triamine.
| Compound Name | 1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopropane-1,2,3-triamine |
|---|---|
| PubChem CID | 118177643 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopropane-1,2,3-triamine |
| SMILES | CN(C)C1C(N(C)C)C1N(C)C |
| InChI | InChI=1S/C9H21N3/c1-10(2)7-8(11(3)4)9(7)12(5)6/h7-9H,1-6H3 |
| InChIKey | UBXHMDIGBLLLGR-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |