C21H30O5 — CID 118177728
(1S,4S,5R,6R,9S,10R,12R,14R)-4,5,6-trihydroxy-7-(methoxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one (PubChem CID 118177728) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1S,4S,5R,6R,9S,10R,12R,14R)-4,5,6-trihydroxy-7-(methoxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one.
| Compound Name | (1S,4S,5R,6R,9S,10R,12R,14R)-4,5,6-trihydroxy-7-(methoxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
|---|---|
| PubChem CID | 118177728 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (1S,4S,5R,6R,9S,10R,12R,14R)-4,5,6-trihydroxy-7-(methoxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
| SMILES | COCC1=C[C@@H]2C(=O)[C@]3(C=C(C)[C@H](O)[C@@]3(O)[C@@H]1O)[C@H](C)C[C@@H]1[C@H]2C1(C)C |
| InChI | InChI=1S/C21H30O5/c1-10-8-20-11(2)6-14-15(19(14,3)4)13(18(20)24)7-12(9-26-5)17(23)21(20,25)16(10)22/h7-8,11,13-17,22-23,25H,6,9H2,1-5H3/t11-,13+,14-,15+,16+,17-,20+,21-/m1/s1 |
| InChIKey | NYOSYCMRIYGXRV-DMUYKADLSA-N |
| XLogP | 1.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|