C26H30F3NO5 — CID 118177765
(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one (PubChem CID 118177765) has the molecular formula C26H30F3NO5 and a molecular weight of 493.52 g/mol. Its IUPAC name is (1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one.
| Compound Name | (1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
|---|---|
| PubChem CID | 118177765 |
| Molecular Formula | C26H30F3NO5 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1Oc1ccc(C(F)(F)F)cn1)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C26H30F3NO5/c1-12-9-24-13(2)7-17-19(23(17,3)4)16(21(24)33)8-14(11-31)20(32)25(24,34)22(12)35-18-6-5-15(10-30-18)26(27,28)29/h5-6,8-10,13,16-17,19-20,22,31-32,34H,7,11H2,1-4H3/t13-,16+,17-,19+,20-,22+,24+,25+/m1/s1 |
| InChIKey | ZMYSZYAUTXOMGX-RNHILABJSA-N |
| XLogP | 3.32 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|