C25H30FNO5 — CID 118177777
(1S,4S,5S,6R,9S,10R,12R,14R)-4-[(3-fluoro-2-pyridinyl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one (PubChem CID 118177777) has the molecular formula C25H30FNO5 and a molecular weight of 443.52 g/mol. Its IUPAC name is (1S,4S,5S,6R,9S,10R,12R,14R)-4-[(3-fluoro-2-pyridinyl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one.
| Compound Name | (1S,4S,5S,6R,9S,10R,12R,14R)-4-[(3-fluoro-2-pyridinyl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
|---|---|
| PubChem CID | 118177777 |
| Molecular Formula | C25H30FNO5 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (1S,4S,5S,6R,9S,10R,12R,14R)-4-[(3-fluoro-2-pyridinyl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1Oc1ncccc1F)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C25H30FNO5/c1-12-10-24-13(2)8-16-18(23(16,3)4)15(20(24)30)9-14(11-28)19(29)25(24,31)21(12)32-22-17(26)6-5-7-27-22/h5-7,9-10,13,15-16,18-19,21,28-29,31H,8,11H2,1-4H3/t13-,15+,16-,18+,19-,21+,24+,25+/m1/s1 |
| InChIKey | BKYRGOHTQNBFGP-JNSBOZTISA-N |
| XLogP | 2.44 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|