About 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid
3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid (PubChem CID 118177801) has the molecular formula C15H31NO4P+
and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid.
Molecular Properties
| Compound Name | 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid |
| PubChem CID | 118177801 |
| Molecular Formula | C15H31NO4P+ |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid |
| SMILES | CCC1C[N+](CCCC=O)(CCCP(=O)(O)O)CC1CC |
| InChI | InChI=1S/C15H30NO4P/c1-3-14-12-16(8-5-6-10-17,13-15(14)4-2)9-7-11-21(18,19)20/h10,14-15H,3-9,11-13H2,1-2H3,(H-,18,19,20)/p+1 |
| InChIKey | PGAUJOIXEXCCEL-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid?
The IUPAC name of 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid (CID 118177801) is 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid.
What is the SMILES notation for 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid?
The canonical SMILES for 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid is CCC1C[N+](CCCC=O)(CCCP(=O)(O)O)CC1CC.
What is the InChIKey of 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid?
The InChIKey is PGAUJOIXEXCCEL-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H30NO4P/c1-3-14-12-16(8-5-6-10-17,13-15(14)4-2)9-7-11-21(18,19)20/h10,14-15H,3-9,11-13H2,1-2H3,(H-,18,19,20)/p+1.
What are the key properties of 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid?
3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid has a molecular weight of 320.39 g/mol, XLogP of 2.42, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,4-diethyl-1-(4-oxobutyl)pyrrolidin-1-ium-1-yl]propylphosphonic acid is sourced from PubChem (CID 118177801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).