C8H11N3O — CID 118178199
N-[2-(methylamino)-4-pyridinyl]acetamide (PubChem CID 118178199) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is N-[2-(methylamino)-4-pyridinyl]acetamide.
| Compound Name | N-[2-(methylamino)-4-pyridinyl]acetamide |
|---|---|
| PubChem CID | 118178199 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | N-[2-(methylamino)-4-pyridinyl]acetamide |
| SMILES | CNc1cc(NC(C)=O)ccn1 |
| InChI | InChI=1S/C8H11N3O/c1-6(12)11-7-3-4-10-8(5-7)9-2/h3-5H,1-2H3,(H2,9,10,11,12) |
| InChIKey | OSLXQNLROVNXIQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |