About N-ethylfuro[3,2-b]pyridin-5-amine
N-ethylfuro[3,2-b]pyridin-5-amine (PubChem CID 118178318) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is N-ethylfuro[3,2-b]pyridin-5-amine.
Molecular Properties
| Compound Name | N-ethylfuro[3,2-b]pyridin-5-amine |
| PubChem CID | 118178318 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | N-ethylfuro[3,2-b]pyridin-5-amine |
| SMILES | CCNc1ccc2occc2n1 |
| InChI | InChI=1S/C9H10N2O/c1-2-10-9-4-3-8-7(11-9)5-6-12-8/h3-6H,2H2,1H3,(H,10,11) |
| InChIKey | BKHSNTLFGGLTBE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethylfuro[3,2-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylfuro[3,2-b]pyridin-5-amine?
The IUPAC name of N-ethylfuro[3,2-b]pyridin-5-amine (CID 118178318) is N-ethylfuro[3,2-b]pyridin-5-amine.
What is the SMILES notation for N-ethylfuro[3,2-b]pyridin-5-amine?
The canonical SMILES for N-ethylfuro[3,2-b]pyridin-5-amine is CCNc1ccc2occc2n1.
What is the InChIKey of N-ethylfuro[3,2-b]pyridin-5-amine?
The InChIKey is BKHSNTLFGGLTBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-2-10-9-4-3-8-7(11-9)5-6-12-8/h3-6H,2H2,1H3,(H,10,11).
What are the key properties of N-ethylfuro[3,2-b]pyridin-5-amine?
N-ethylfuro[3,2-b]pyridin-5-amine has a molecular weight of 162.19 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylfuro[3,2-b]pyridin-5-amine is sourced from PubChem (CID 118178318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).