About 1-methyl-3,8a-dihydroindolizine
1-methyl-3,8a-dihydroindolizine (PubChem CID 118179093) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 1-methyl-3,8a-dihydroindolizine.
Molecular Properties
| Compound Name | 1-methyl-3,8a-dihydroindolizine |
| PubChem CID | 118179093 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 1-methyl-3,8a-dihydroindolizine |
| SMILES | CC1=CCN2C=CC=CC12 |
| InChI | InChI=1S/C9H11N/c1-8-5-7-10-6-3-2-4-9(8)10/h2-6,9H,7H2,1H3 |
| InChIKey | BXPXYNMOJYDAEV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3,8a-dihydroindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,8a-dihydroindolizine?
The IUPAC name of 1-methyl-3,8a-dihydroindolizine (CID 118179093) is 1-methyl-3,8a-dihydroindolizine.
What is the SMILES notation for 1-methyl-3,8a-dihydroindolizine?
The canonical SMILES for 1-methyl-3,8a-dihydroindolizine is CC1=CCN2C=CC=CC12.
What is the InChIKey of 1-methyl-3,8a-dihydroindolizine?
The InChIKey is BXPXYNMOJYDAEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N/c1-8-5-7-10-6-3-2-4-9(8)10/h2-6,9H,7H2,1H3.
What are the key properties of 1-methyl-3,8a-dihydroindolizine?
1-methyl-3,8a-dihydroindolizine has a molecular weight of 133.19 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,8a-dihydroindolizine is sourced from PubChem (CID 118179093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).