C14H20O3 — CID 118179636
(7'aR)-4'-ethyl-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,6,7-tetrahydroindene]-1'-one (PubChem CID 118179636) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (7'aR)-4'-ethyl-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,6,7-tetrahydroindene]-1'-one.
| Compound Name | (7'aR)-4'-ethyl-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,6,7-tetrahydroindene]-1'-one |
|---|---|
| PubChem CID | 118179636 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (7'aR)-4'-ethyl-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,6,7-tetrahydroindene]-1'-one |
| SMILES | CCC1=C2CCC(=O)[C@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C14H20O3/c1-3-10-11-4-5-12(15)13(11,2)6-7-14(10)16-8-9-17-14/h3-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | OFHGOZMIYCDLLF-CYBMUJFWSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|