C8H14ClFO — CID 118180564
(2S,3S,4R,5R)-3-chloro-5-ethyl-3-fluoro-2,4-dimethyloxolane (PubChem CID 118180564) has the molecular formula C8H14ClFO and a molecular weight of 180.65 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3-chloro-5-ethyl-3-fluoro-2,4-dimethyloxolane.
| Compound Name | (2S,3S,4R,5R)-3-chloro-5-ethyl-3-fluoro-2,4-dimethyloxolane |
|---|---|
| PubChem CID | 118180564 |
| Molecular Formula | C8H14ClFO |
| Molecular Weight | 180.65 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | (2S,3S,4R,5R)-3-chloro-5-ethyl-3-fluoro-2,4-dimethyloxolane |
| SMILES | CC[C@H]1O[C@@H](C)[C@@](F)(Cl)[C@@H]1C |
| InChI | InChI=1S/C8H14ClFO/c1-4-7-5(2)8(9,10)6(3)11-7/h5-7H,4H2,1-3H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | WXDMOWAUOUKELN-ULAWRXDQSA-N |
| XLogP | 2.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.65 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|