C7H11Cl2FO — CID 118180592
(3S,4R,5R)-2,3-dichloro-5-ethyl-3-fluoro-4-methyloxolane (PubChem CID 118180592) has the molecular formula C7H11Cl2FO and a molecular weight of 201.07 g/mol. Its IUPAC name is (3S,4R,5R)-2,3-dichloro-5-ethyl-3-fluoro-4-methyloxolane.
| Compound Name | (3S,4R,5R)-2,3-dichloro-5-ethyl-3-fluoro-4-methyloxolane |
|---|---|
| PubChem CID | 118180592 |
| Molecular Formula | C7H11Cl2FO |
| Molecular Weight | 201.07 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | (3S,4R,5R)-2,3-dichloro-5-ethyl-3-fluoro-4-methyloxolane |
| SMILES | CC[C@H]1OC(Cl)[C@@](F)(Cl)[C@@H]1C |
| InChI | InChI=1S/C7H11Cl2FO/c1-3-5-4(2)7(9,10)6(8)11-5/h4-6H,3H2,1-2H3/t4-,5-,6?,7-/m1/s1 |
| InChIKey | IKKDBFFOSHCERG-RARXMTEBSA-N |
| XLogP | 2.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.07 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|