About 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole
2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (PubChem CID 118180756) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
Molecular Properties
| Compound Name | 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| PubChem CID | 118180756 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| SMILES | COc1cc2n(n1)CCC2 |
| InChI | InChI=1S/C7H10N2O/c1-10-7-5-6-3-2-4-9(6)8-7/h5H,2-4H2,1H3 |
| InChIKey | XRAMNCMHYJTBFW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The IUPAC name of 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (CID 118180756) is 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
What is the SMILES notation for 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The canonical SMILES for 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is COc1cc2n(n1)CCC2.
What is the InChIKey of 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The InChIKey is XRAMNCMHYJTBFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-10-7-5-6-3-2-4-9(6)8-7/h5H,2-4H2,1H3.
What are the key properties of 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole has a molecular weight of 138.17 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is sourced from PubChem (CID 118180756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).