C6H10F6N2 — CID 118180973
2-N'-ethyl-1,1,1,3,3,3-hexafluoro-2-N-methylpropane-2,2-diamine (PubChem CID 118180973) has the molecular formula C6H10F6N2 and a molecular weight of 224.15 g/mol. Its IUPAC name is 2-N'-ethyl-1,1,1,3,3,3-hexafluoro-2-N-methylpropane-2,2-diamine.
| Compound Name | 2-N'-ethyl-1,1,1,3,3,3-hexafluoro-2-N-methylpropane-2,2-diamine |
|---|---|
| PubChem CID | 118180973 |
| Molecular Formula | C6H10F6N2 |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-N'-ethyl-1,1,1,3,3,3-hexafluoro-2-N-methylpropane-2,2-diamine |
| SMILES | CCNC(NC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H10F6N2/c1-3-14-4(13-2,5(7,8)9)6(10,11)12/h13-14H,3H2,1-2H3 |
| InChIKey | SILBIWOHQZKXHY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|