C13H24F6N2 — CID 118180986
1,1,1,3,3,3-hexafluoro-2-N'-(2-methylbutan-2-yl)-2-N-(2-methylbutyl)propane-2,2-diamine (PubChem CID 118180986) has the molecular formula C13H24F6N2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-N'-(2-methylbutan-2-yl)-2-N-(2-methylbutyl)propane-2,2-diamine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-N'-(2-methylbutan-2-yl)-2-N-(2-methylbutyl)propane-2,2-diamine |
|---|---|
| PubChem CID | 118180986 |
| Molecular Formula | C13H24F6N2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-N'-(2-methylbutan-2-yl)-2-N-(2-methylbutyl)propane-2,2-diamine |
| SMILES | CCC(C)CNC(NC(C)(C)CC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H24F6N2/c1-6-9(3)8-20-11(12(14,15)16,13(17,18)19)21-10(4,5)7-2/h9,20-21H,6-8H2,1-5H3 |
| InChIKey | IYGFWZVGRQDPCV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|