C23H24F3N5O6S — CID 118181062
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-2-(acetamidomethyl)-4-imidazo[1,2-a]pyridin-3-ylsulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 118181062) has the molecular formula C23H24F3N5O6S and a molecular weight of 555.54 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-2-(acetamidomethyl)-4-imidazo[1,2-a]pyridin-3-ylsulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-2-(acetamidomethyl)-4-imidazo[1,2-a]pyridin-3-ylsulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 118181062 |
| Molecular Formula | C23H24F3N5O6S |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(2S)-2-(acetamidomethyl)-4-imidazo[1,2-a]pyridin-3-ylsulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | CC(=O)NC[C@H]1CN(S(=O)(=O)c2cnc3ccccn23)c2cc(NC(=O)OC(C)(C)C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C23H24F3N5O6S/c1-14(32)27-11-16-13-31(38(34,35)20-12-28-19-6-4-5-9-30(19)20)17-10-15(7-8-18(17)36-16)29-21(33)37-22(2,3)23(24,25)26/h4-10,12,16H,11,13H2,1-3H3,(H,27,32)(H,29,33)/t16-/m0/s1 |
| InChIKey | NCDLPNFKRGGSRZ-INIZCTEOSA-N |
| XLogP | 3.32 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |