C17H26N2 — CID 118181312
1-N'-[(3E)-3-ethenylhexa-1,3-dien-2-yl]-1-N-[(3Z)-2-methylidenehexa-3,5-dienyl]ethane-1,1-diamine (PubChem CID 118181312) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-N'-[(3E)-3-ethenylhexa-1,3-dien-2-yl]-1-N-[(3Z)-2-methylidenehexa-3,5-dienyl]ethane-1,1-diamine.
| Compound Name | 1-N'-[(3E)-3-ethenylhexa-1,3-dien-2-yl]-1-N-[(3Z)-2-methylidenehexa-3,5-dienyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 118181312 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-N'-[(3E)-3-ethenylhexa-1,3-dien-2-yl]-1-N-[(3Z)-2-methylidenehexa-3,5-dienyl]ethane-1,1-diamine |
| SMILES | C=C/C=C\C(=C)CNC(C)NC(=C)/C(C=C)=C/CC |
| InChI | InChI=1S/C17H26N2/c1-7-10-12-14(4)13-18-16(6)19-15(5)17(9-3)11-8-2/h7,9-12,16,18-19H,1,3-5,8,13H2,2,6H3/b12-10-,17-11+ |
| InChIKey | CJSYDEFFHXJFIB-KCILXYFRSA-N |
| XLogP | 3.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|