C15H25N — CID 118181314
(3Z,4E)-N-[(Z)-pent-2-enyl]-3-propylidenehepta-4,6-dien-2-amine (PubChem CID 118181314) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (3Z,4E)-N-[(Z)-pent-2-enyl]-3-propylidenehepta-4,6-dien-2-amine.
| Compound Name | (3Z,4E)-N-[(Z)-pent-2-enyl]-3-propylidenehepta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 118181314 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (3Z,4E)-N-[(Z)-pent-2-enyl]-3-propylidenehepta-4,6-dien-2-amine |
| SMILES | C=C/C=C/C(=C/CC)C(C)NC/C=C\CC |
| InChI | InChI=1S/C15H25N/c1-5-8-10-13-16-14(4)15(11-7-3)12-9-6-2/h6,8-12,14,16H,2,5,7,13H2,1,3-4H3/b10-8-,12-9+,15-11- |
| InChIKey | HJFZRVBQJDMZQE-JOVOITPGSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|