C18H10O3 — CID 11818168
6-phenyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione (PubChem CID 11818168) has the molecular formula C18H10O3 and a molecular weight of 274.27 g/mol. Its IUPAC name is 6-phenyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione.
| Compound Name | 6-phenyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 11818168 |
| Molecular Formula | C18H10O3 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 6-phenyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
| SMILES | O=C1OC(=O)c2c(-c3ccccc3)ccc3cccc1c23 |
| InChI | InChI=1S/C18H10O3/c19-17-14-8-4-7-12-9-10-13(11-5-2-1-3-6-11)16(15(12)14)18(20)21-17/h1-10H |
| InChIKey | ISOSGRNBACDIEA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|