About [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate
[3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate (PubChem CID 118181781) has the molecular formula C21H18ClN3O4S
and a molecular weight of 443.91 g/mol. Its IUPAC name is [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate.
Molecular Properties
| Compound Name | [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate |
| PubChem CID | 118181781 |
| Molecular Formula | C21H18ClN3O4S |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate |
| SMILES | O=C(OC1C=c2oc(=O)c(-c3nc4c(Cl)cccc4s3)cc2=CC1)N1CCNCC1 |
| InChI | InChI=1S/C21H18ClN3O4S/c22-15-2-1-3-17-18(15)24-19(30-17)14-10-12-4-5-13(11-16(12)29-20(14)26)28-21(27)25-8-6-23-7-9-25/h1-4,10-11,13,23H,5-9H2 |
| InChIKey | FKWQEZJKZSKFKW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate?
The IUPAC name of [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate (CID 118181781) is [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate.
What is the SMILES notation for [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate?
The canonical SMILES for [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate is O=C(OC1C=c2oc(=O)c(-c3nc4c(Cl)cccc4s3)cc2=CC1)N1CCNCC1.
What is the InChIKey of [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate?
The InChIKey is FKWQEZJKZSKFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClN3O4S/c22-15-2-1-3-17-18(15)24-19(30-17)14-10-12-4-5-13(11-16(12)29-20(14)26)28-21(27)25-8-6-23-7-9-25/h1-4,10-11,13,23H,5-9H2.
What are the key properties of [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate?
[3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate has a molecular weight of 443.91 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chloro-1,3-benzothiazol-2-yl)-2-oxo-6,7-dihydrochromen-7-yl] piperazine-1-carboxylate is sourced from PubChem (CID 118181781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).