C13H9F5N4S2 — CID 118181868
6-(3-ethylsulfanyl-2-pyridinyl)-2-(1,1,2,2,2-pentafluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 118181868) has the molecular formula C13H9F5N4S2 and a molecular weight of 380.37 g/mol. Its IUPAC name is 6-(3-ethylsulfanyl-2-pyridinyl)-2-(1,1,2,2,2-pentafluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-(3-ethylsulfanyl-2-pyridinyl)-2-(1,1,2,2,2-pentafluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 118181868 |
| Molecular Formula | C13H9F5N4S2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 6-(3-ethylsulfanyl-2-pyridinyl)-2-(1,1,2,2,2-pentafluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | CCSc1cccnc1-c1cn2nc(C(F)(F)C(F)(F)F)sc2n1 |
| InChI | InChI=1S/C13H9F5N4S2/c1-2-23-8-4-3-5-19-9(8)7-6-22-11(20-7)24-10(21-22)12(14,15)13(16,17)18/h3-6H,2H2,1H3 |
| InChIKey | QACLVWUQZMBVTF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|