About 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal
8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal (PubChem CID 118182157) has the molecular formula C21H34O3
and a molecular weight of 334.50 g/mol. Its IUPAC name is 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal.
Molecular Properties
| Compound Name | 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal |
| PubChem CID | 118182157 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal |
| SMILES | O=CCCCCCCCC1(CCCCC2=CC=CCC2)OCCO1 |
| InChI | InChI=1S/C21H34O3/c22-17-11-4-2-1-3-9-15-21(23-18-19-24-21)16-10-8-14-20-12-6-5-7-13-20/h5-6,12,17H,1-4,7-11,13-16,18-19H2 |
| InChIKey | BTJWZEOHVZGUHH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal?
The IUPAC name of 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal (CID 118182157) is 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal.
What is the SMILES notation for 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal?
The canonical SMILES for 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal is O=CCCCCCCCC1(CCCCC2=CC=CCC2)OCCO1.
What is the InChIKey of 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal?
The InChIKey is BTJWZEOHVZGUHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34O3/c22-17-11-4-2-1-3-9-15-21(23-18-19-24-21)16-10-8-14-20-12-6-5-7-13-20/h5-6,12,17H,1-4,7-11,13-16,18-19H2.
What are the key properties of 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal?
8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal has a molecular weight of 334.50 g/mol, XLogP of 5.50, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2-(4-cyclohexa-1,3-dien-1-ylbutyl)-1,3-dioxolan-2-yl]octanal is sourced from PubChem (CID 118182157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).