C20H17BrF2O3 — CID 118182821
ethyl (1S,1aS,6aR)-4-[(3-bromo-2,6-difluorophenyl)methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylate (PubChem CID 118182821) has the molecular formula C20H17BrF2O3 and a molecular weight of 423.25 g/mol. Its IUPAC name is ethyl (1S,1aS,6aR)-4-[(3-bromo-2,6-difluorophenyl)methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylate.
| Compound Name | ethyl (1S,1aS,6aR)-4-[(3-bromo-2,6-difluorophenyl)methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylate |
|---|---|
| PubChem CID | 118182821 |
| Molecular Formula | C20H17BrF2O3 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | ethyl (1S,1aS,6aR)-4-[(3-bromo-2,6-difluorophenyl)methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2Cc3cc(OCc4c(F)ccc(Br)c4F)ccc3[C@@H]21 |
| InChI | InChI=1S/C20H17BrF2O3/c1-2-25-20(24)18-13-8-10-7-11(3-4-12(10)17(13)18)26-9-14-16(22)6-5-15(21)19(14)23/h3-7,13,17-18H,2,8-9H2,1H3/t13-,17+,18+/m1/s1 |
| InChIKey | PTPFHTNRFJPAQO-BVGQSLNGSA-N |
| XLogP | 4.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|