About 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole
5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole (PubChem CID 118183167) has the molecular formula C23H20F2N2O3
and a molecular weight of 410.42 g/mol. Its IUPAC name is 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole.
Molecular Properties
| Compound Name | 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole |
| PubChem CID | 118183167 |
| Molecular Formula | C23H20F2N2O3 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole |
| SMILES | CCC(F)(F)Oc1ccc(-c2ccc3onc(OCc4ncccc4C)c3c2)cc1 |
| InChI | InChI=1S/C23H20F2N2O3/c1-3-23(24,25)29-18-9-6-16(7-10-18)17-8-11-21-19(13-17)22(27-30-21)28-14-20-15(2)5-4-12-26-20/h4-13H,3,14H2,1-2H3 |
| InChIKey | MIEGNMSINREZDO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole?
The IUPAC name of 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole (CID 118183167) is 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole.
What is the SMILES notation for 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole?
The canonical SMILES for 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole is CCC(F)(F)Oc1ccc(-c2ccc3onc(OCc4ncccc4C)c3c2)cc1.
What is the InChIKey of 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole?
The InChIKey is MIEGNMSINREZDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F2N2O3/c1-3-23(24,25)29-18-9-6-16(7-10-18)17-8-11-21-19(13-17)22(27-30-21)28-14-20-15(2)5-4-12-26-20/h4-13H,3,14H2,1-2H3.
What are the key properties of 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole?
5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole has a molecular weight of 410.42 g/mol, XLogP of 6.16, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(1,1-difluoropropoxy)phenyl]-3-[(3-methyl-2-pyridinyl)methoxy]-1,2-benzoxazole is sourced from PubChem (CID 118183167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).