About 2-(oxan-4-yl)benzoyl iodide
2-(oxan-4-yl)benzoyl iodide (PubChem CID 118183273) has the molecular formula C12H13IO2
and a molecular weight of 316.14 g/mol. Its IUPAC name is 2-(oxan-4-yl)benzoyl iodide.
Molecular Properties
| Compound Name | 2-(oxan-4-yl)benzoyl iodide |
| PubChem CID | 118183273 |
| Molecular Formula | C12H13IO2 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 2-(oxan-4-yl)benzoyl iodide |
| SMILES | O=C(I)c1ccccc1C1CCOCC1 |
| InChI | InChI=1S/C12H13IO2/c13-12(14)11-4-2-1-3-10(11)9-5-7-15-8-6-9/h1-4,9H,5-8H2 |
| InChIKey | ZJMHQSHGXPPYTH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxan-4-yl)benzoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-yl)benzoyl iodide?
The IUPAC name of 2-(oxan-4-yl)benzoyl iodide (CID 118183273) is 2-(oxan-4-yl)benzoyl iodide.
What is the SMILES notation for 2-(oxan-4-yl)benzoyl iodide?
The canonical SMILES for 2-(oxan-4-yl)benzoyl iodide is O=C(I)c1ccccc1C1CCOCC1.
What is the InChIKey of 2-(oxan-4-yl)benzoyl iodide?
The InChIKey is ZJMHQSHGXPPYTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13IO2/c13-12(14)11-4-2-1-3-10(11)9-5-7-15-8-6-9/h1-4,9H,5-8H2.
What are the key properties of 2-(oxan-4-yl)benzoyl iodide?
2-(oxan-4-yl)benzoyl iodide has a molecular weight of 316.14 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-yl)benzoyl iodide is sourced from PubChem (CID 118183273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).