C18H26N2O5 — CID 118183525
9-butoxy-6-(methoxymethyl)-2-methylspiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxolane]-1,8-dione (PubChem CID 118183525) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 9-butoxy-6-(methoxymethyl)-2-methylspiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxolane]-1,8-dione.
| Compound Name | 9-butoxy-6-(methoxymethyl)-2-methylspiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxolane]-1,8-dione |
|---|---|
| PubChem CID | 118183525 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 9-butoxy-6-(methoxymethyl)-2-methylspiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxolane]-1,8-dione |
| SMILES | CCCCOc1c2n(c(COC)cc1=O)CC1(CCOC1)N(C)C2=O |
| InChI | InChI=1S/C18H26N2O5/c1-4-5-7-25-16-14(21)9-13(10-23-3)20-11-18(6-8-24-12-18)19(2)17(22)15(16)20/h9H,4-8,10-12H2,1-3H3 |
| InChIKey | PQVMZXKMTZBRQX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|