About (2S,5S)-2,5-bis(fluoromethyl)oxolane
(2S,5S)-2,5-bis(fluoromethyl)oxolane (PubChem CID 118183548) has the molecular formula C6H10F2O
and a molecular weight of 136.14 g/mol. Its IUPAC name is (2S,5S)-2,5-bis(fluoromethyl)oxolane.
Molecular Properties
| Compound Name | (2S,5S)-2,5-bis(fluoromethyl)oxolane |
| PubChem CID | 118183548 |
| Molecular Formula | C6H10F2O |
| Molecular Weight | 136.14 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | (2S,5S)-2,5-bis(fluoromethyl)oxolane |
| SMILES | FC[C@@H]1CC[C@@H](CF)O1 |
| InChI | InChI=1S/C6H10F2O/c7-3-5-1-2-6(4-8)9-5/h5-6H,1-4H2/t5-,6-/m0/s1 |
| InChIKey | YVYHMNXSRQSFGP-WDSKDSINSA-N |
| XLogP | 1.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.14 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,5S)-2,5-bis(fluoromethyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-2,5-bis(fluoromethyl)oxolane?
The IUPAC name of (2S,5S)-2,5-bis(fluoromethyl)oxolane (CID 118183548) is (2S,5S)-2,5-bis(fluoromethyl)oxolane.
What is the SMILES notation for (2S,5S)-2,5-bis(fluoromethyl)oxolane?
The canonical SMILES for (2S,5S)-2,5-bis(fluoromethyl)oxolane is FC[C@@H]1CC[C@@H](CF)O1.
What is the InChIKey of (2S,5S)-2,5-bis(fluoromethyl)oxolane?
The InChIKey is YVYHMNXSRQSFGP-WDSKDSINSA-N. The full InChI is InChI=1S/C6H10F2O/c7-3-5-1-2-6(4-8)9-5/h5-6H,1-4H2/t5-,6-/m0/s1.
What are the key properties of (2S,5S)-2,5-bis(fluoromethyl)oxolane?
(2S,5S)-2,5-bis(fluoromethyl)oxolane has a molecular weight of 136.14 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-2,5-bis(fluoromethyl)oxolane is sourced from PubChem (CID 118183548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).