C18H25BrN2O4 — CID 118183647
7-bromo-9-butoxy-2-ethylspiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxane]-1,8-dione (PubChem CID 118183647) has the molecular formula C18H25BrN2O4 and a molecular weight of 413.31 g/mol. Its IUPAC name is 7-bromo-9-butoxy-2-ethylspiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxane]-1,8-dione.
| Compound Name | 7-bromo-9-butoxy-2-ethylspiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxane]-1,8-dione |
|---|---|
| PubChem CID | 118183647 |
| Molecular Formula | C18H25BrN2O4 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 7-bromo-9-butoxy-2-ethylspiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxane]-1,8-dione |
| SMILES | CCCCOc1c2n(cc(Br)c1=O)CC1(CCCOC1)N(CC)C2=O |
| InChI | InChI=1S/C18H25BrN2O4/c1-3-5-9-25-16-14-17(23)21(4-2)18(7-6-8-24-12-18)11-20(14)10-13(19)15(16)22/h10H,3-9,11-12H2,1-2H3 |
| InChIKey | GTKITRYKCFIAKA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|