About 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane
3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane (PubChem CID 11818371) has the molecular formula C9H12F6O3
and a molecular weight of 282.18 g/mol. Its IUPAC name is 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane.
Molecular Properties
| Compound Name | 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane |
| PubChem CID | 11818371 |
| Molecular Formula | C9H12F6O3 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane |
| SMILES | FC(F)(F)COCC1(COCC(F)(F)F)COC1 |
| InChI | InChI=1S/C9H12F6O3/c10-8(11,12)5-17-3-7(1-16-2-7)4-18-6-9(13,14)15/h1-6H2 |
| InChIKey | VMJRXKQPAMYKLG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane?
The IUPAC name of 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane (CID 11818371) is 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane.
What is the SMILES notation for 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane?
The canonical SMILES for 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane is FC(F)(F)COCC1(COCC(F)(F)F)COC1.
What is the InChIKey of 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane?
The InChIKey is VMJRXKQPAMYKLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F6O3/c10-8(11,12)5-17-3-7(1-16-2-7)4-18-6-9(13,14)15/h1-6H2.
What are the key properties of 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane?
3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane has a molecular weight of 282.18 g/mol, XLogP of 2.16, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(2,2,2-trifluoroethoxymethyl)oxetane is sourced from PubChem (CID 11818371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).