C24H14F6O8S2 — CID 118183798
[5-phenyl-2-(trifluoromethylsulfonyloxy)-5,11-dihydrochromeno[4,3-c]chromen-8-yl] trifluoromethanesulfonate (PubChem CID 118183798) has the molecular formula C24H14F6O8S2 and a molecular weight of 608.49 g/mol. Its IUPAC name is [5-phenyl-2-(trifluoromethylsulfonyloxy)-5,11-dihydrochromeno[4,3-c]chromen-8-yl] trifluoromethanesulfonate.
| Compound Name | [5-phenyl-2-(trifluoromethylsulfonyloxy)-5,11-dihydrochromeno[4,3-c]chromen-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118183798 |
| Molecular Formula | C24H14F6O8S2 |
| Molecular Weight | 608.49 g/mol |
| Exact Mass | 608.00 |
| IUPAC Name | [5-phenyl-2-(trifluoromethylsulfonyloxy)-5,11-dihydrochromeno[4,3-c]chromen-8-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)OC(c1ccccc1)C1=C2COc2cc(OS(=O)(=O)C(F)(F)F)ccc21)C(F)(F)F |
| InChI | InChI=1S/C24H14F6O8S2/c25-23(26,27)39(31,32)37-14-7-9-17-19(10-14)35-12-18-16-8-6-15(38-40(33,34)24(28,29)30)11-20(16)36-22(21(17)18)13-4-2-1-3-5-13/h1-11,22H,12H2 |
| InChIKey | DIDQCFIXGWHMQV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|