C24H27F2N3O5 — CID 118183891
9-butoxy-N-[(2,4-difluorophenyl)methyl]-2-methyl-1,8-dioxospiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxolane]-7-carboxamide (PubChem CID 118183891) has the molecular formula C24H27F2N3O5 and a molecular weight of 475.49 g/mol. Its IUPAC name is 9-butoxy-N-[(2,4-difluorophenyl)methyl]-2-methyl-1,8-dioxospiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxolane]-7-carboxamide.
| Compound Name | 9-butoxy-N-[(2,4-difluorophenyl)methyl]-2-methyl-1,8-dioxospiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxolane]-7-carboxamide |
|---|---|
| PubChem CID | 118183891 |
| Molecular Formula | C24H27F2N3O5 |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 9-butoxy-N-[(2,4-difluorophenyl)methyl]-2-methyl-1,8-dioxospiro[4H-pyrido[1,2-a]pyrazine-3,3'-oxolane]-7-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)CC1(CCOC1)N(C)C2=O |
| InChI | InChI=1S/C24H27F2N3O5/c1-3-4-8-34-21-19-23(32)28(2)24(7-9-33-14-24)13-29(19)12-17(20(21)30)22(31)27-11-15-5-6-16(25)10-18(15)26/h5-6,10,12H,3-4,7-9,11,13-14H2,1-2H3,(H,27,31) |
| InChIKey | SYAOHZGXDDQXJL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|