About 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine
4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine (PubChem CID 118184538) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine.
Molecular Properties
| Compound Name | 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine |
| PubChem CID | 118184538 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine |
| SMILES | CN1CCNc2cc(N)cnc21 |
| InChI | InChI=1S/C8H12N4/c1-12-3-2-10-7-4-6(9)5-11-8(7)12/h4-5,10H,2-3,9H2,1H3 |
| InChIKey | PLNGOBFDOJRLAH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine?
The IUPAC name of 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine (CID 118184538) is 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine.
What is the SMILES notation for 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine?
The canonical SMILES for 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine is CN1CCNc2cc(N)cnc21.
What is the InChIKey of 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine?
The InChIKey is PLNGOBFDOJRLAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-12-3-2-10-7-4-6(9)5-11-8(7)12/h4-5,10H,2-3,9H2,1H3.
What are the key properties of 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine?
4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine has a molecular weight of 164.21 g/mol, XLogP of 0.53, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dihydro-1H-pyrido[2,3-b]pyrazin-7-amine is sourced from PubChem (CID 118184538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).